C12H26N2 — CID 123588936
4-ethyl-1-N',2-dimethyloct-6-ene-1,1-diamine (PubChem CID 123588936) has the molecular formula C12H26N2 and a molecular weight of 198.35 g/mol. Its IUPAC name is 4-ethyl-1-N',2-dimethyloct-6-ene-1,1-diamine.
| Compound Name | 4-ethyl-1-N',2-dimethyloct-6-ene-1,1-diamine |
|---|---|
| PubChem CID | 123588936 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | 4-ethyl-1-N',2-dimethyloct-6-ene-1,1-diamine |
| SMILES | CC=CCC(CC)CC(C)C(N)NC |
| InChI | InChI=1S/C12H26N2/c1-5-7-8-11(6-2)9-10(3)12(13)14-4/h5,7,10-12,14H,6,8-9,13H2,1-4H3 |
| InChIKey | WMIHFNBLIFGJJG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|