C18H18FNO2S — CID 123589747
ethyl 3-(2-amino-5-benzylsulfanyl-4-fluorophenyl)prop-2-enoate (PubChem CID 123589747) has the molecular formula C18H18FNO2S and a molecular weight of 331.41 g/mol. Its IUPAC name is ethyl 3-(2-amino-5-benzylsulfanyl-4-fluorophenyl)prop-2-enoate.
| Compound Name | ethyl 3-(2-amino-5-benzylsulfanyl-4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 123589747 |
| Molecular Formula | C18H18FNO2S |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | ethyl 3-(2-amino-5-benzylsulfanyl-4-fluorophenyl)prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1cc(SCc2ccccc2)c(F)cc1N |
| InChI | InChI=1S/C18H18FNO2S/c1-2-22-18(21)9-8-14-10-17(15(19)11-16(14)20)23-12-13-6-4-3-5-7-13/h3-11H,2,12,20H2,1H3 |
| InChIKey | XIPCCILOWOXMCR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|