C18H14F3NO2 — CID 123593619
3-phenyl-5-[(2,4,5-trifluorophenyl)methyl]-3,6-dihydro-2H-1,4-oxazepin-7-one (PubChem CID 123593619) has the molecular formula C18H14F3NO2 and a molecular weight of 333.31 g/mol. Its IUPAC name is 3-phenyl-5-[(2,4,5-trifluorophenyl)methyl]-3,6-dihydro-2H-1,4-oxazepin-7-one.
| Compound Name | 3-phenyl-5-[(2,4,5-trifluorophenyl)methyl]-3,6-dihydro-2H-1,4-oxazepin-7-one |
|---|---|
| PubChem CID | 123593619 |
| Molecular Formula | C18H14F3NO2 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 3-phenyl-5-[(2,4,5-trifluorophenyl)methyl]-3,6-dihydro-2H-1,4-oxazepin-7-one |
| SMILES | O=C1CC(Cc2cc(F)c(F)cc2F)=NC(c2ccccc2)CO1 |
| InChI | InChI=1S/C18H14F3NO2/c19-14-9-16(21)15(20)7-12(14)6-13-8-18(23)24-10-17(22-13)11-4-2-1-3-5-11/h1-5,7,9,17H,6,8,10H2 |
| InChIKey | AFBQKMDOZOHWEY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|