C16H19F2NO — CID 123593771
6-(2,4-difluorophenyl)-3-(3-ethoxypropyl)-3,4-dihydropyridine (PubChem CID 123593771) has the molecular formula C16H19F2NO and a molecular weight of 279.33 g/mol. Its IUPAC name is 6-(2,4-difluorophenyl)-3-(3-ethoxypropyl)-3,4-dihydropyridine.
| Compound Name | 6-(2,4-difluorophenyl)-3-(3-ethoxypropyl)-3,4-dihydropyridine |
|---|---|
| PubChem CID | 123593771 |
| Molecular Formula | C16H19F2NO |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 6-(2,4-difluorophenyl)-3-(3-ethoxypropyl)-3,4-dihydropyridine |
| SMILES | CCOCCCC1C=NC(c2ccc(F)cc2F)=CC1 |
| InChI | InChI=1S/C16H19F2NO/c1-2-20-9-3-4-12-5-8-16(19-11-12)14-7-6-13(17)10-15(14)18/h6-8,10-12H,2-5,9H2,1H3 |
| InChIKey | PZJVCUAZRXUBOX-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|