C27H32N6O2Si — CID 123594014
3-[[6-[[5-[2-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-2-pyridinyl]oxy]quinolin-2-yl]methylamino]propanenitrile (PubChem CID 123594014) has the molecular formula C27H32N6O2Si and a molecular weight of 500.68 g/mol. Its IUPAC name is 3-[[6-[[5-[2-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-2-pyridinyl]oxy]quinolin-2-yl]methylamino]propanenitrile.
| Compound Name | 3-[[6-[[5-[2-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-2-pyridinyl]oxy]quinolin-2-yl]methylamino]propanenitrile |
|---|---|
| PubChem CID | 123594014 |
| Molecular Formula | C27H32N6O2Si |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | 3-[[6-[[5-[2-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-2-pyridinyl]oxy]quinolin-2-yl]methylamino]propanenitrile |
| SMILES | C[Si](C)(C)CCOCn1nccc1-c1ccc(Oc2ccc3nc(CNCCC#N)ccc3c2)nc1 |
| InChI | InChI=1S/C27H32N6O2Si/c1-36(2,3)16-15-34-20-33-26(11-14-31-33)22-6-10-27(30-18-22)35-24-8-9-25-21(17-24)5-7-23(32-25)19-29-13-4-12-28/h5-11,14,17-18,29H,4,13,15-16,19-20H2,1-3H3 |
| InChIKey | BTKDZJNLJMRLNC-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 97.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|