C28H36F2N2O3 — CID 123595775
14-(dimethylamino)-9,11-difluoro-6-methyl-5-(2-pyridin-3-ylethenyl)-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadec-4-ene-12,13-diol (PubChem CID 123595775) has the molecular formula C28H36F2N2O3 and a molecular weight of 486.60 g/mol. Its IUPAC name is 14-(dimethylamino)-9,11-difluoro-6-methyl-5-(2-pyridin-3-ylethenyl)-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadec-4-ene-12,13-diol.
| Compound Name | 14-(dimethylamino)-9,11-difluoro-6-methyl-5-(2-pyridin-3-ylethenyl)-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadec-4-ene-12,13-diol |
|---|---|
| PubChem CID | 123595775 |
| Molecular Formula | C28H36F2N2O3 |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | 14-(dimethylamino)-9,11-difluoro-6-methyl-5-(2-pyridin-3-ylethenyl)-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadec-4-ene-12,13-diol |
| SMILES | CN(C)C1CC23CCC4(O2)C2CC=C(C=Cc5cccnc5)C2(C)CCC4(F)CC3(F)C(O)C1O |
| InChI | InChI=1S/C28H36F2N2O3/c1-24-10-11-25(29)17-27(30)23(34)22(33)20(32(2)3)15-26(27)12-13-28(25,35-26)21(24)9-8-19(24)7-6-18-5-4-14-31-16-18/h4-8,14,16,20-23,33-34H,9-13,15,17H2,1-3H3 |
| InChIKey | FHUHHMRWXUFTQG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 65.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |