C30H35FN2O3 — CID 123505580
14-(dimethylamino)-11-fluoro-5-isoquinolin-8-yl-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8-diene-12,13-diol (PubChem CID 123505580) has the molecular formula C30H35FN2O3 and a molecular weight of 490.62 g/mol. Its IUPAC name is 14-(dimethylamino)-11-fluoro-5-isoquinolin-8-yl-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8-diene-12,13-diol.
| Compound Name | 14-(dimethylamino)-11-fluoro-5-isoquinolin-8-yl-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8-diene-12,13-diol |
|---|---|
| PubChem CID | 123505580 |
| Molecular Formula | C30H35FN2O3 |
| Molecular Weight | 490.62 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | 14-(dimethylamino)-11-fluoro-5-isoquinolin-8-yl-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8-diene-12,13-diol |
| SMILES | CN(C)C1CC23CCC4(O2)C(=CCC2(C)C(c5cccc6ccncc56)=CCC24)CC3(F)C(O)C1O |
| InChI | InChI=1S/C30H35FN2O3/c1-27-11-9-19-15-30(31)26(35)25(34)23(33(2)3)16-28(30)12-13-29(19,36-28)24(27)8-7-22(27)20-6-4-5-18-10-14-32-17-21(18)20/h4-7,9-10,14,17,23-26,34-35H,8,11-13,15-16H2,1-3H3 |
| InChIKey | MLHMOLXAHWVQMO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 65.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.62 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|