C31H36N2O3 — CID 90340422
(1S,6S,13R,14R,15S,17R)-15-(dimethylamino)-5-isoquinolin-5-yl-6-methyl-20-oxahexacyclo[15.2.1.01,9.02,6.010,12.012,17]icosa-4,8-diene-13,14-diol (PubChem CID 90340422) has the molecular formula C31H36N2O3 and a molecular weight of 484.64 g/mol. Its IUPAC name is (1S,6S,13R,14R,15S,17R)-15-(dimethylamino)-5-isoquinolin-5-yl-6-methyl-20-oxahexacyclo[15.2.1.01,9.02,6.010,12.012,17]icosa-4,8-diene-13,14-diol.
| Compound Name | (1S,6S,13R,14R,15S,17R)-15-(dimethylamino)-5-isoquinolin-5-yl-6-methyl-20-oxahexacyclo[15.2.1.01,9.02,6.010,12.012,17]icosa-4,8-diene-13,14-diol |
|---|---|
| PubChem CID | 90340422 |
| Molecular Formula | C31H36N2O3 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | (1S,6S,13R,14R,15S,17R)-15-(dimethylamino)-5-isoquinolin-5-yl-6-methyl-20-oxahexacyclo[15.2.1.01,9.02,6.010,12.012,17]icosa-4,8-diene-13,14-diol |
| SMILES | CN(C)[C@H]1C[C@@]23CC[C@@]4(O2)C(=CC[C@]2(C)C(c5cccc6cnccc56)=CCC24)C2CC23[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C31H36N2O3/c1-28-11-9-22-23-15-30(23)27(35)26(34)24(33(2)3)16-29(30)12-13-31(22,36-29)25(28)8-7-21(28)20-6-4-5-18-17-32-14-10-19(18)20/h4-7,9-10,14,17,23-27,34-35H,8,11-13,15-16H2,1-3H3/t23?,24-,25?,26+,27-,28+,29+,30?,31+/m0/s1 |
| InChIKey | QLHKBJQHKGBRCX-MRXOSULRSA-N |
| XLogP | 4.34 |
| TPSA | 65.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|