C32H38N2O3 — CID 123926196
14-(dimethylamino)-5-isoquinolin-8-yl-6,7,7-trimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol (PubChem CID 123926196) has the molecular formula C32H38N2O3 and a molecular weight of 498.67 g/mol. Its IUPAC name is 14-(dimethylamino)-5-isoquinolin-8-yl-6,7,7-trimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol.
| Compound Name | 14-(dimethylamino)-5-isoquinolin-8-yl-6,7,7-trimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol |
|---|---|
| PubChem CID | 123926196 |
| Molecular Formula | C32H38N2O3 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.29 |
| IUPAC Name | 14-(dimethylamino)-5-isoquinolin-8-yl-6,7,7-trimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol |
| SMILES | CN(C)C1CC23CCC4(O2)C(=CC(C)(C)C2(C)C(c5cccc6ccncc56)=CCC42)C=C3C(O)C1O |
| InChI | InChI=1S/C32H38N2O3/c1-29(2)16-20-15-24-27(35)28(36)25(34(4)5)17-31(24)12-13-32(20,37-31)26-10-9-23(30(26,29)3)21-8-6-7-19-11-14-33-18-22(19)21/h6-9,11,14-16,18,25-28,35-36H,10,12-13,17H2,1-5H3 |
| InChIKey | DUDKIVAZMYQTHD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 65.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |