C31H36N2O3 — CID 123513927
14-(dimethylamino)-6,7-dimethyl-5-quinolin-6-yl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol (PubChem CID 123513927) has the molecular formula C31H36N2O3 and a molecular weight of 484.64 g/mol. Its IUPAC name is 14-(dimethylamino)-6,7-dimethyl-5-quinolin-6-yl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol.
| Compound Name | 14-(dimethylamino)-6,7-dimethyl-5-quinolin-6-yl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol |
|---|---|
| PubChem CID | 123513927 |
| Molecular Formula | C31H36N2O3 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | 14-(dimethylamino)-6,7-dimethyl-5-quinolin-6-yl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol |
| SMILES | CC1C=C2C=C3C(O)C(O)C(N(C)C)CC34CCC2(O4)C2CC=C(c3ccc4ncccc4c3)C12C |
| InChI | InChI=1S/C31H36N2O3/c1-18-14-21-16-23-27(34)28(35)25(33(3)4)17-30(23)11-12-31(21,36-30)26-10-8-22(29(18,26)2)19-7-9-24-20(15-19)6-5-13-32-24/h5-9,13-16,18,25-28,34-35H,10-12,17H2,1-4H3 |
| InChIKey | GKXYDBJEFSYCPL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 65.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |