C29H36N4O3 — CID 123161169
5-(3-amino-1H-indazol-5-yl)-14-(dimethylamino)-6,7-dimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol (PubChem CID 123161169) has the molecular formula C29H36N4O3 and a molecular weight of 488.63 g/mol. Its IUPAC name is 5-(3-amino-1H-indazol-5-yl)-14-(dimethylamino)-6,7-dimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol.
| Compound Name | 5-(3-amino-1H-indazol-5-yl)-14-(dimethylamino)-6,7-dimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol |
|---|---|
| PubChem CID | 123161169 |
| Molecular Formula | C29H36N4O3 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | 5-(3-amino-1H-indazol-5-yl)-14-(dimethylamino)-6,7-dimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol |
| SMILES | CC1C=C2C=C3C(O)C(O)C(N(C)C)CC34CCC2(O4)C2CC=C(c3ccc4[nH]nc(N)c4c3)C12C |
| InChI | InChI=1S/C29H36N4O3/c1-15-11-17-13-20-24(34)25(35)22(33(3)4)14-28(20)9-10-29(17,36-28)23-8-6-19(27(15,23)2)16-5-7-21-18(12-16)26(30)32-31-21/h5-7,11-13,15,22-25,34-35H,8-10,14H2,1-4H3,(H3,30,31,32) |
| InChIKey | GLTXFUCOCARPRF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 107.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |