C30H35N3O3 — CID 123385507
14-(dimethylamino)-6,7-dimethyl-5-quinazolin-7-yl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol (PubChem CID 123385507) has the molecular formula C30H35N3O3 and a molecular weight of 485.63 g/mol. Its IUPAC name is 14-(dimethylamino)-6,7-dimethyl-5-quinazolin-7-yl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol.
| Compound Name | 14-(dimethylamino)-6,7-dimethyl-5-quinazolin-7-yl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol |
|---|---|
| PubChem CID | 123385507 |
| Molecular Formula | C30H35N3O3 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | 14-(dimethylamino)-6,7-dimethyl-5-quinazolin-7-yl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol |
| SMILES | CC1C=C2C=C3C(O)C(O)C(N(C)C)CC34CCC2(O4)C2CC=C(c3ccc4cncnc4c3)C12C |
| InChI | InChI=1S/C30H35N3O3/c1-17-11-20-13-22-26(34)27(35)24(33(3)4)14-29(22)9-10-30(20,36-29)25-8-7-21(28(17,25)2)18-5-6-19-15-31-16-32-23(19)12-18/h5-7,11-13,15-17,24-27,34-35H,8-10,14H2,1-4H3 |
| InChIKey | TXHBVGGHDGFUHH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 78.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |