C31H37N3O3 — CID 123635020
5-(3-aminoisoquinolin-7-yl)-14-(dimethylamino)-6,8-dimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol (PubChem CID 123635020) has the molecular formula C31H37N3O3 and a molecular weight of 499.66 g/mol. Its IUPAC name is 5-(3-aminoisoquinolin-7-yl)-14-(dimethylamino)-6,8-dimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol.
| Compound Name | 5-(3-aminoisoquinolin-7-yl)-14-(dimethylamino)-6,8-dimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol |
|---|---|
| PubChem CID | 123635020 |
| Molecular Formula | C31H37N3O3 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | 5-(3-aminoisoquinolin-7-yl)-14-(dimethylamino)-6,8-dimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol |
| SMILES | CC1=C2C=C3C(O)C(O)C(N(C)C)CC34CCC2(O4)C2CC=C(c3ccc4cc(N)ncc4c3)C2(C)C1 |
| InChI | InChI=1S/C31H37N3O3/c1-17-14-29(2)21(19-6-5-18-12-26(32)33-16-20(18)11-19)7-8-25(29)31-10-9-30(37-31)15-24(34(3)4)28(36)27(35)23(30)13-22(17)31/h5-7,11-13,16,24-25,27-28,35-36H,8-10,14-15H2,1-4H3,(H2,32,33) |
| InChIKey | SLURCOOEBOQGDL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |