C29H34N2O4 — CID 123157424
5-(1,3-benzoxazol-6-yl)-14-(dimethylamino)-6,8-dimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol (PubChem CID 123157424) has the molecular formula C29H34N2O4 and a molecular weight of 474.60 g/mol. Its IUPAC name is 5-(1,3-benzoxazol-6-yl)-14-(dimethylamino)-6,8-dimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol.
| Compound Name | 5-(1,3-benzoxazol-6-yl)-14-(dimethylamino)-6,8-dimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol |
|---|---|
| PubChem CID | 123157424 |
| Molecular Formula | C29H34N2O4 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | 5-(1,3-benzoxazol-6-yl)-14-(dimethylamino)-6,8-dimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol |
| SMILES | CC1=C2C=C3C(O)C(O)C(N(C)C)CC34CCC2(O4)C2CC=C(c3ccc4ncoc4c3)C2(C)C1 |
| InChI | InChI=1S/C29H34N2O4/c1-16-13-27(2)18(17-5-7-21-23(11-17)34-15-30-21)6-8-24(27)29-10-9-28(35-29)14-22(31(3)4)26(33)25(32)20(28)12-19(16)29/h5-7,11-12,15,22,24-26,32-33H,8-10,13-14H2,1-4H3 |
| InChIKey | JMYMNNPTBSKECW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |