C29H35N3O3 — CID 123856426
14-(dimethylamino)-5-(1H-indazol-5-yl)-6,8-dimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol (PubChem CID 123856426) has the molecular formula C29H35N3O3 and a molecular weight of 473.62 g/mol. Its IUPAC name is 14-(dimethylamino)-5-(1H-indazol-5-yl)-6,8-dimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol.
| Compound Name | 14-(dimethylamino)-5-(1H-indazol-5-yl)-6,8-dimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol |
|---|---|
| PubChem CID | 123856426 |
| Molecular Formula | C29H35N3O3 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | 14-(dimethylamino)-5-(1H-indazol-5-yl)-6,8-dimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol |
| SMILES | CC1=C2C=C3C(O)C(O)C(N(C)C)CC34CCC2(O4)C2CC=C(c3ccc4[nH]ncc4c3)C2(C)C1 |
| InChI | InChI=1S/C29H35N3O3/c1-16-13-27(2)19(17-5-7-22-18(11-17)15-30-31-22)6-8-24(27)29-10-9-28(35-29)14-23(32(3)4)26(34)25(33)21(28)12-20(16)29/h5-7,11-12,15,23-26,33-34H,8-10,13-14H2,1-4H3,(H,30,31) |
| InChIKey | NHKBRUOGHZDZQP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 81.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |