C29H32F3N3O3 — CID 123562729
14-(dimethylamino)-5-(1H-indazol-5-yl)-6-methyl-8-(trifluoromethyl)-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol (PubChem CID 123562729) has the molecular formula C29H32F3N3O3 and a molecular weight of 527.59 g/mol. Its IUPAC name is 14-(dimethylamino)-5-(1H-indazol-5-yl)-6-methyl-8-(trifluoromethyl)-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol.
| Compound Name | 14-(dimethylamino)-5-(1H-indazol-5-yl)-6-methyl-8-(trifluoromethyl)-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol |
|---|---|
| PubChem CID | 123562729 |
| Molecular Formula | C29H32F3N3O3 |
| Molecular Weight | 527.59 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | 14-(dimethylamino)-5-(1H-indazol-5-yl)-6-methyl-8-(trifluoromethyl)-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol |
| SMILES | CN(C)C1CC23CCC4(O2)C(=C(C(F)(F)F)CC2(C)C(c5ccc6[nH]ncc6c5)=CCC24)C=C3C(O)C1O |
| InChI | InChI=1S/C29H32F3N3O3/c1-26-12-20(29(30,31)32)18-11-19-24(36)25(37)22(35(2)3)13-27(19)8-9-28(18,38-27)23(26)7-5-17(26)15-4-6-21-16(10-15)14-33-34-21/h4-6,10-11,14,22-25,36-37H,7-9,12-13H2,1-3H3,(H,33,34) |
| InChIKey | PGGKMIAUCDSXLP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 81.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.59 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |