C28H36N2O3 — CID 123984023
14-(dimethylamino)-6,7,7-trimethyl-5-pyridin-3-yl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol (PubChem CID 123984023) has the molecular formula C28H36N2O3 and a molecular weight of 448.61 g/mol. Its IUPAC name is 14-(dimethylamino)-6,7,7-trimethyl-5-pyridin-3-yl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol.
| Compound Name | 14-(dimethylamino)-6,7,7-trimethyl-5-pyridin-3-yl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol |
|---|---|
| PubChem CID | 123984023 |
| Molecular Formula | C28H36N2O3 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | 14-(dimethylamino)-6,7,7-trimethyl-5-pyridin-3-yl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol |
| SMILES | CN(C)C1CC23CCC4(O2)C(=CC(C)(C)C2(C)C(c5cccnc5)=CCC42)C=C3C(O)C1O |
| InChI | InChI=1S/C28H36N2O3/c1-25(2)14-18-13-20-23(31)24(32)21(30(4)5)15-27(20)10-11-28(18,33-27)22-9-8-19(26(22,25)3)17-7-6-12-29-16-17/h6-8,12-14,16,21-24,31-32H,9-11,15H2,1-5H3 |
| InChIKey | JKLCOGBELCYWAC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 65.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |