C26H33ClN2O3 — CID 90340900
(1S,6S,12R,13R,14S,16R)-9-chloro-14-(dimethylamino)-6-methyl-5-pyridin-4-yl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,10-diene-12,13-diol (PubChem CID 90340900) has the molecular formula C26H33ClN2O3 and a molecular weight of 457.01 g/mol. Its IUPAC name is (1S,6S,12R,13R,14S,16R)-9-chloro-14-(dimethylamino)-6-methyl-5-pyridin-4-yl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,10-diene-12,13-diol.
| Compound Name | (1S,6S,12R,13R,14S,16R)-9-chloro-14-(dimethylamino)-6-methyl-5-pyridin-4-yl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,10-diene-12,13-diol |
|---|---|
| PubChem CID | 90340900 |
| Molecular Formula | C26H33ClN2O3 |
| Molecular Weight | 457.01 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | (1S,6S,12R,13R,14S,16R)-9-chloro-14-(dimethylamino)-6-methyl-5-pyridin-4-yl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,10-diene-12,13-diol |
| SMILES | CN(C)[C@H]1C[C@@]23CC[C@]4(O2)C2CC=C(c5ccncc5)[C@@]2(C)CCC4(Cl)C=C3[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C26H33ClN2O3/c1-23-8-10-25(27)14-18-21(30)22(31)19(29(2)3)15-24(18)9-11-26(25,32-24)20(23)5-4-17(23)16-6-12-28-13-7-16/h4,6-7,12-14,19-22,30-31H,5,8-11,15H2,1-3H3/t19-,20?,21+,22+,23+,24+,25?,26-/m0/s1 |
| InChIKey | PIRDGWGCHPDBAH-GOAPTLNNSA-N |
| XLogP | 3.55 |
| TPSA | 65.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.01 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|