C31H33F3N2O2 — CID 144682691
(1S,14S,16R)-14-(dimethylamino)-5-isoquinolin-8-yl-6-methyl-8-(trifluoromethyl)-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-trien-13-ol (PubChem CID 144682691) has the molecular formula C31H33F3N2O2 and a molecular weight of 522.61 g/mol. Its IUPAC name is (1S,14S,16R)-14-(dimethylamino)-5-isoquinolin-8-yl-6-methyl-8-(trifluoromethyl)-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-trien-13-ol.
| Compound Name | (1S,14S,16R)-14-(dimethylamino)-5-isoquinolin-8-yl-6-methyl-8-(trifluoromethyl)-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-trien-13-ol |
|---|---|
| PubChem CID | 144682691 |
| Molecular Formula | C31H33F3N2O2 |
| Molecular Weight | 522.61 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | (1S,14S,16R)-14-(dimethylamino)-5-isoquinolin-8-yl-6-methyl-8-(trifluoromethyl)-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-trien-13-ol |
| SMILES | CN(C)[C@H]1C[C@@]23CC[C@@]4(O2)C(=C(C(F)(F)F)CC2(C)C(c5cccc6ccncc56)=CCC24)C=C3CC1O |
| InChI | InChI=1S/C31H33F3N2O2/c1-28-15-24(31(32,33)34)23-13-19-14-26(37)25(36(2)3)16-29(19)10-11-30(23,38-29)27(28)8-7-22(28)20-6-4-5-18-9-12-35-17-21(18)20/h4-7,9,12-13,17,25-27,37H,8,10-11,14-16H2,1-3H3/t25-,26?,27?,28?,29+,30+/m0/s1 |
| InChIKey | IUJGJAZMBNPKJW-GVUZSMCJSA-N |
| XLogP | 6.22 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.61 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |