C27H34N2O3 — CID 123774107
15-(dimethylamino)-6-methyl-5-pyridin-4-yl-20-oxahexacyclo[15.2.1.01,9.02,6.010,12.012,17]icosa-4,8-diene-13,14-diol (PubChem CID 123774107) has the molecular formula C27H34N2O3 and a molecular weight of 434.58 g/mol. Its IUPAC name is 15-(dimethylamino)-6-methyl-5-pyridin-4-yl-20-oxahexacyclo[15.2.1.01,9.02,6.010,12.012,17]icosa-4,8-diene-13,14-diol.
| Compound Name | 15-(dimethylamino)-6-methyl-5-pyridin-4-yl-20-oxahexacyclo[15.2.1.01,9.02,6.010,12.012,17]icosa-4,8-diene-13,14-diol |
|---|---|
| PubChem CID | 123774107 |
| Molecular Formula | C27H34N2O3 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | 15-(dimethylamino)-6-methyl-5-pyridin-4-yl-20-oxahexacyclo[15.2.1.01,9.02,6.010,12.012,17]icosa-4,8-diene-13,14-diol |
| SMILES | CN(C)C1CC23CCC4(O2)C(=CCC2(C)C(c5ccncc5)=CCC24)C2CC23C(O)C1O |
| InChI | InChI=1S/C27H34N2O3/c1-24-9-6-18-19-14-26(19)23(31)22(30)20(29(2)3)15-25(26)10-11-27(18,32-25)21(24)5-4-17(24)16-7-12-28-13-8-16/h4,6-8,12-13,19-23,30-31H,5,9-11,14-15H2,1-3H3 |
| InChIKey | JGACGRGIEQXZPH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 65.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|