C30H36FN3O3 — CID 123176773
5-(3-aminoisoquinolin-6-yl)-14-(dimethylamino)-11-fluoro-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8-diene-12,13-diol (PubChem CID 123176773) has the molecular formula C30H36FN3O3 and a molecular weight of 505.63 g/mol. Its IUPAC name is 5-(3-aminoisoquinolin-6-yl)-14-(dimethylamino)-11-fluoro-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8-diene-12,13-diol.
| Compound Name | 5-(3-aminoisoquinolin-6-yl)-14-(dimethylamino)-11-fluoro-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8-diene-12,13-diol |
|---|---|
| PubChem CID | 123176773 |
| Molecular Formula | C30H36FN3O3 |
| Molecular Weight | 505.63 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | 5-(3-aminoisoquinolin-6-yl)-14-(dimethylamino)-11-fluoro-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8-diene-12,13-diol |
| SMILES | CN(C)C1CC23CCC4(O2)C(=CCC2(C)C(c5ccc6cnc(N)cc6c5)=CCC24)CC3(F)C(O)C1O |
| InChI | InChI=1S/C30H36FN3O3/c1-27-9-8-20-14-30(31)26(36)25(35)22(34(2)3)15-28(30)10-11-29(20,37-28)23(27)7-6-21(27)17-4-5-18-16-33-24(32)13-19(18)12-17/h4-6,8,12-13,16,22-23,25-26,35-36H,7,9-11,14-15H2,1-3H3,(H2,32,33) |
| InChIKey | NVZFBXWWOLAFQW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.63 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|