About 1,3-diethyl-1-methyl-2,2-di(propan-2-yl)cyclopropane
1,3-diethyl-1-methyl-2,2-di(propan-2-yl)cyclopropane (PubChem CID 123596430) has the molecular formula C14H28
and a molecular weight of 196.38 g/mol. Its IUPAC name is 1,3-diethyl-1-methyl-2,2-di(propan-2-yl)cyclopropane.
Analyze 1,3-diethyl-1-methyl-2,2-di(propan-2-yl)cyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diethyl-1-methyl-2,2-di(propan-2-yl)cyclopropane?
The IUPAC name of 1,3-diethyl-1-methyl-2,2-di(propan-2-yl)cyclopropane (CID 123596430) is 1,3-diethyl-1-methyl-2,2-di(propan-2-yl)cyclopropane.
What is the SMILES notation for 1,3-diethyl-1-methyl-2,2-di(propan-2-yl)cyclopropane?
The canonical SMILES for 1,3-diethyl-1-methyl-2,2-di(propan-2-yl)cyclopropane is CCC1C(C)(CC)C1(C(C)C)C(C)C.
What is the InChIKey of 1,3-diethyl-1-methyl-2,2-di(propan-2-yl)cyclopropane?
The InChIKey is HTOWHQAPJNFDPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28/c1-8-12-13(7,9-2)14(12,10(3)4)11(5)6/h10-12H,8-9H2,1-7H3.
What are the key properties of 1,3-diethyl-1-methyl-2,2-di(propan-2-yl)cyclopropane?
1,3-diethyl-1-methyl-2,2-di(propan-2-yl)cyclopropane has a molecular weight of 196.38 g/mol, XLogP of 4.74, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diethyl-1-methyl-2,2-di(propan-2-yl)cyclopropane is sourced from PubChem (CID 123596430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).