C17H30 — CID 123344294
1,2,3-triethyl-1-penta-1,3-dien-2-yl-2-propan-2-ylcyclopropane (PubChem CID 123344294) has the molecular formula C17H30 and a molecular weight of 234.43 g/mol. Its IUPAC name is 1,2,3-triethyl-1-penta-1,3-dien-2-yl-2-propan-2-ylcyclopropane.
| Compound Name | 1,2,3-triethyl-1-penta-1,3-dien-2-yl-2-propan-2-ylcyclopropane |
|---|---|
| PubChem CID | 123344294 |
| Molecular Formula | C17H30 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.23 |
| IUPAC Name | 1,2,3-triethyl-1-penta-1,3-dien-2-yl-2-propan-2-ylcyclopropane |
| SMILES | C=C(C=CC)C1(CC)C(CC)C1(CC)C(C)C |
| InChI | InChI=1S/C17H30/c1-8-12-14(7)17(11-4)15(9-2)16(17,10-3)13(5)6/h8,12-13,15H,7,9-11H2,1-6H3 |
| InChIKey | NVUBWIJMFOKKIH-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|