C15H24N2O3 — CID 123598621
4-[[4-methyl-2-(methyliminomethyl)pent-2-enoyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 123598621) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 4-[[4-methyl-2-(methyliminomethyl)pent-2-enoyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[4-methyl-2-(methyliminomethyl)pent-2-enoyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 123598621 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 4-[[4-methyl-2-(methyliminomethyl)pent-2-enoyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | C/N=C/C(=CC(C)C)C(=O)NC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C15H24N2O3/c1-10(2)8-12(9-16-3)14(18)17-13-6-4-11(5-7-13)15(19)20/h8-11,13H,4-7H2,1-3H3,(H,17,18)(H,19,20)/b12-8?,16-9+ |
| InChIKey | MRTIHOSWBDOSKY-QUHAKXFWSA-N |
| XLogP | 2.03 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|