C14H27F — CID 123599295
5-fluoro-2,7,10-trimethylundec-3-ene (PubChem CID 123599295) has the molecular formula C14H27F and a molecular weight of 214.37 g/mol. Its IUPAC name is 5-fluoro-2,7,10-trimethylundec-3-ene.
| Compound Name | 5-fluoro-2,7,10-trimethylundec-3-ene |
|---|---|
| PubChem CID | 123599295 |
| Molecular Formula | C14H27F |
| Molecular Weight | 214.37 g/mol |
| Exact Mass | 214.21 |
| IUPAC Name | 5-fluoro-2,7,10-trimethylundec-3-ene |
| SMILES | CC(C)C=CC(F)CC(C)CCC(C)C |
| InChI | InChI=1S/C14H27F/c1-11(2)6-8-13(5)10-14(15)9-7-12(3)4/h7,9,11-14H,6,8,10H2,1-5H3 |
| InChIKey | NRATWLRULVBDLH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.37 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|