C11H19O3P — CID 123599491
1-diethoxyphosphoryl-1,2-bis(ethenyl)cyclopropane (PubChem CID 123599491) has the molecular formula C11H19O3P and a molecular weight of 230.24 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-1,2-bis(ethenyl)cyclopropane.
| Compound Name | 1-diethoxyphosphoryl-1,2-bis(ethenyl)cyclopropane |
|---|---|
| PubChem CID | 123599491 |
| Molecular Formula | C11H19O3P |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 1-diethoxyphosphoryl-1,2-bis(ethenyl)cyclopropane |
| SMILES | C=CC1CC1(C=C)P(=O)(OCC)OCC |
| InChI | InChI=1S/C11H19O3P/c1-5-10-9-11(10,6-2)15(12,13-7-3)14-8-4/h5-6,10H,1-2,7-9H2,3-4H3 |
| InChIKey | GWBDXNQSVFUVAW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|