C24H24N4O5 — CID 123599950
methyl 2-[2-[3-[2-(3-hydroxy-1-methyl-2-oxopyrrolidin-3-yl)ethynyl]anilino]-5-(methylcarbamoyl)phenyl]-2-iminoacetate (PubChem CID 123599950) has the molecular formula C24H24N4O5 and a molecular weight of 448.48 g/mol. Its IUPAC name is methyl 2-[2-[3-[2-(3-hydroxy-1-methyl-2-oxopyrrolidin-3-yl)ethynyl]anilino]-5-(methylcarbamoyl)phenyl]-2-iminoacetate.
| Compound Name | methyl 2-[2-[3-[2-(3-hydroxy-1-methyl-2-oxopyrrolidin-3-yl)ethynyl]anilino]-5-(methylcarbamoyl)phenyl]-2-iminoacetate |
|---|---|
| PubChem CID | 123599950 |
| Molecular Formula | C24H24N4O5 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | methyl 2-[2-[3-[2-(3-hydroxy-1-methyl-2-oxopyrrolidin-3-yl)ethynyl]anilino]-5-(methylcarbamoyl)phenyl]-2-iminoacetate |
| SMILES | [H]/N=C(\C(=O)OC)c1cc(C(=O)NC)ccc1Nc1cccc(C#CC2(O)CCN(C)C2=O)c1 |
| InChI | InChI=1S/C24H24N4O5/c1-26-21(29)16-7-8-19(18(14-16)20(25)22(30)33-3)27-17-6-4-5-15(13-17)9-10-24(32)11-12-28(2)23(24)31/h4-8,13-14,25,27,32H,11-12H2,1-3H3,(H,26,29)/b25-20- |
| InChIKey | DQHDNNCNMKFUKV-QQTULTPQSA-N |
| XLogP | 1.28 |
| TPSA | 131.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|