C23H30FN3O2 — CID 123600486
5-ethyl-6-[(4-fluoro-1-phenyl-4-propylcyclohexyl)amino]-N-hydroxypyridine-3-carboxamide (PubChem CID 123600486) has the molecular formula C23H30FN3O2 and a molecular weight of 399.51 g/mol. Its IUPAC name is 5-ethyl-6-[(4-fluoro-1-phenyl-4-propylcyclohexyl)amino]-N-hydroxypyridine-3-carboxamide.
| Compound Name | 5-ethyl-6-[(4-fluoro-1-phenyl-4-propylcyclohexyl)amino]-N-hydroxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 123600486 |
| Molecular Formula | C23H30FN3O2 |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | 5-ethyl-6-[(4-fluoro-1-phenyl-4-propylcyclohexyl)amino]-N-hydroxypyridine-3-carboxamide |
| SMILES | CCCC1(F)CCC(Nc2ncc(C(=O)NO)cc2CC)(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H30FN3O2/c1-3-10-22(24)11-13-23(14-12-22,19-8-6-5-7-9-19)26-20-17(4-2)15-18(16-25-20)21(28)27-29/h5-9,15-16,29H,3-4,10-14H2,1-2H3,(H,25,26)(H,27,28) |
| InChIKey | FXJBBKJIOYHYKO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|