C20H30N2O3 — CID 123603167
1-[(Z)-1-butoxy-6-methoxyhex-4-en-3-ylidene]-3-(1-phenylethyl)urea (PubChem CID 123603167) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is 1-[(Z)-1-butoxy-6-methoxyhex-4-en-3-ylidene]-3-(1-phenylethyl)urea.
| Compound Name | 1-[(Z)-1-butoxy-6-methoxyhex-4-en-3-ylidene]-3-(1-phenylethyl)urea |
|---|---|
| PubChem CID | 123603167 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 1-[(Z)-1-butoxy-6-methoxyhex-4-en-3-ylidene]-3-(1-phenylethyl)urea |
| SMILES | CCCCOCCC(/C=C\COC)=NC(=O)NC(C)c1ccccc1 |
| InChI | InChI=1S/C20H30N2O3/c1-4-5-15-25-16-13-19(12-9-14-24-3)22-20(23)21-17(2)18-10-7-6-8-11-18/h6-12,17H,4-5,13-16H2,1-3H3,(H,21,23)/b12-9-,22-19? |
| InChIKey | HZYGNESVMLVLTE-ZZUNTGIKSA-N |
| XLogP | 4.31 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|