C8H13N — CID 123603457
5,5-dimethyl-2,6-dihydroazepine (PubChem CID 123603457) has the molecular formula C8H13N and a molecular weight of 123.20 g/mol. Its IUPAC name is 5,5-dimethyl-2,6-dihydroazepine.
| Compound Name | 5,5-dimethyl-2,6-dihydroazepine |
|---|---|
| PubChem CID | 123603457 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | 5,5-dimethyl-2,6-dihydroazepine |
| SMILES | CC1(C)C=CCN=CC1 |
| InChI | InChI=1S/C8H13N/c1-8(2)4-3-6-9-7-5-8/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | PDCKVELFZSAQEQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|