C23H23BrClN3O3 — CID 1236045
(E)-3-[3-[(2-bromo-4-chlorophenoxy)methyl]-4-methoxyphenyl]-N-[(1-ethylpyrazol-4-yl)methyl]prop-2-enamide (PubChem CID 1236045) has the molecular formula C23H23BrClN3O3 and a molecular weight of 504.81 g/mol. Its IUPAC name is (E)-3-[3-[(2-bromo-4-chlorophenoxy)methyl]-4-methoxyphenyl]-N-[(1-ethylpyrazol-4-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-[3-[(2-bromo-4-chlorophenoxy)methyl]-4-methoxyphenyl]-N-[(1-ethylpyrazol-4-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 1236045 |
| Molecular Formula | C23H23BrClN3O3 |
| Molecular Weight | 504.81 g/mol |
| Exact Mass | 503.06 |
| IUPAC Name | (E)-3-[3-[(2-bromo-4-chlorophenoxy)methyl]-4-methoxyphenyl]-N-[(1-ethylpyrazol-4-yl)methyl]prop-2-enamide |
| SMILES | CCn1cc(CNC(=O)/C=C/c2ccc(OC)c(COc3ccc(Cl)cc3Br)c2)cn1 |
| InChI | InChI=1S/C23H23BrClN3O3/c1-3-28-14-17(13-27-28)12-26-23(29)9-5-16-4-7-21(30-2)18(10-16)15-31-22-8-6-19(25)11-20(22)24/h4-11,13-14H,3,12,15H2,1-2H3,(H,26,29)/b9-5+ |
| InChIKey | AYJBTBJMRJELCE-WEVVVXLNSA-N |
| XLogP | 5.24 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.81 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|