C22H21BrClN3O3 — CID 92903679
(Z)-3-[3-[(2-bromo-4-chlorophenoxy)methyl]-4-methoxyphenyl]-N-[(1-methylpyrazol-4-yl)methyl]prop-2-enamide (PubChem CID 92903679) has the molecular formula C22H21BrClN3O3 and a molecular weight of 490.79 g/mol. Its IUPAC name is (Z)-3-[3-[(2-bromo-4-chlorophenoxy)methyl]-4-methoxyphenyl]-N-[(1-methylpyrazol-4-yl)methyl]prop-2-enamide.
| Compound Name | (Z)-3-[3-[(2-bromo-4-chlorophenoxy)methyl]-4-methoxyphenyl]-N-[(1-methylpyrazol-4-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 92903679 |
| Molecular Formula | C22H21BrClN3O3 |
| Molecular Weight | 490.79 g/mol |
| Exact Mass | 489.05 |
| IUPAC Name | (Z)-3-[3-[(2-bromo-4-chlorophenoxy)methyl]-4-methoxyphenyl]-N-[(1-methylpyrazol-4-yl)methyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C\C(=O)NCc2cnn(C)c2)cc1COc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C22H21BrClN3O3/c1-27-13-16(12-26-27)11-25-22(28)8-4-15-3-6-20(29-2)17(9-15)14-30-21-7-5-18(24)10-19(21)23/h3-10,12-13H,11,14H2,1-2H3,(H,25,28)/b8-4- |
| InChIKey | DYOKJZIKRWUUKH-YWEYNIOJSA-N |
| XLogP | 4.75 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.79 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|