C21H18BrClN2O3 — CID 19543253
(E)-3-[3-[(4-bromo-2-chlorophenoxy)methyl]-4-methoxyphenyl]-1-(1-methylpyrazol-4-yl)prop-2-en-1-one (PubChem CID 19543253) has the molecular formula C21H18BrClN2O3 and a molecular weight of 461.74 g/mol. Its IUPAC name is (E)-3-[3-[(4-bromo-2-chlorophenoxy)methyl]-4-methoxyphenyl]-1-(1-methylpyrazol-4-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[3-[(4-bromo-2-chlorophenoxy)methyl]-4-methoxyphenyl]-1-(1-methylpyrazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19543253 |
| Molecular Formula | C21H18BrClN2O3 |
| Molecular Weight | 461.74 g/mol |
| Exact Mass | 460.02 |
| IUPAC Name | (E)-3-[3-[(4-bromo-2-chlorophenoxy)methyl]-4-methoxyphenyl]-1-(1-methylpyrazol-4-yl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2cnn(C)c2)cc1COc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C21H18BrClN2O3/c1-25-12-16(11-24-25)19(26)6-3-14-4-7-20(27-2)15(9-14)13-28-21-8-5-17(22)10-18(21)23/h3-12H,13H2,1-2H3/b6-3+ |
| InChIKey | WGCOFUSSJNJSGA-ZZXKWVIFSA-N |
| XLogP | 5.32 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.74 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|