C33H31NO7 — CID 123604836
2-acetyl-5,10,12a-trihydroxy-3,6-dimethyl-9-[4-(4-methylphenyl)-1H-pyrrol-2-yl]-4,4a,5,5a,6,11a-hexahydrotetracene-1,11,12-trione (PubChem CID 123604836) has the molecular formula C33H31NO7 and a molecular weight of 553.61 g/mol. Its IUPAC name is 2-acetyl-5,10,12a-trihydroxy-3,6-dimethyl-9-[4-(4-methylphenyl)-1H-pyrrol-2-yl]-4,4a,5,5a,6,11a-hexahydrotetracene-1,11,12-trione.
| Compound Name | 2-acetyl-5,10,12a-trihydroxy-3,6-dimethyl-9-[4-(4-methylphenyl)-1H-pyrrol-2-yl]-4,4a,5,5a,6,11a-hexahydrotetracene-1,11,12-trione |
|---|---|
| PubChem CID | 123604836 |
| Molecular Formula | C33H31NO7 |
| Molecular Weight | 553.61 g/mol |
| Exact Mass | 553.21 |
| IUPAC Name | 2-acetyl-5,10,12a-trihydroxy-3,6-dimethyl-9-[4-(4-methylphenyl)-1H-pyrrol-2-yl]-4,4a,5,5a,6,11a-hexahydrotetracene-1,11,12-trione |
| SMILES | CC(=O)C1=C(C)CC2C(O)C3C(C(=O)c4c(ccc(-c5cc(-c6ccc(C)cc6)c[nH]5)c4O)C3C)C(=O)C2(O)C1=O |
| InChI | InChI=1S/C33H31NO7/c1-14-5-7-18(8-6-14)19-12-23(34-13-19)21-10-9-20-16(3)25-27(30(38)26(20)28(21)36)32(40)33(41)22(29(25)37)11-15(2)24(17(4)35)31(33)39/h5-10,12-13,16,22,25,27,29,34,36-37,41H,11H2,1-4H3 |
| InChIKey | VDGNJCLPEXPPFI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 144.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.61 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|