C26H24N2O7 — CID 90789256
(4aS,5aR,12aS)-10,12a-dihydroxy-7-[2-(2-methyl-1H-pyrrol-3-yl)ethenyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 90789256) has the molecular formula C26H24N2O7 and a molecular weight of 476.49 g/mol. Its IUPAC name is (4aS,5aR,12aS)-10,12a-dihydroxy-7-[2-(2-methyl-1H-pyrrol-3-yl)ethenyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-10,12a-dihydroxy-7-[2-(2-methyl-1H-pyrrol-3-yl)ethenyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90789256 |
| Molecular Formula | C26H24N2O7 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | (4aS,5aR,12aS)-10,12a-dihydroxy-7-[2-(2-methyl-1H-pyrrol-3-yl)ethenyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | Cc1[nH]ccc1C=Cc1ccc(O)c2c1C[C@H]1C[C@H]3CC(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C26H24N2O7/c1-11-12(6-7-28-11)2-3-13-4-5-17(29)20-16(13)9-14-8-15-10-18(30)21(25(27)34)24(33)26(15,35)23(32)19(14)22(20)31/h2-7,14-15,19,21,28-29,35H,8-10H2,1H3,(H2,27,34)/t14-,15+,19?,21?,26+/m1/s1 |
| InChIKey | VYJPKBGDRFYLCE-SVFFIIRLSA-N |
| XLogP | 1.13 |
| TPSA | 167.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|