C24H19FN2O7 — CID 90804029
(4aS,5aR,12aS)-7-(6-fluoro-3-pyridinyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 90804029) has the molecular formula C24H19FN2O7 and a molecular weight of 466.42 g/mol. Its IUPAC name is (4aS,5aR,12aS)-7-(6-fluoro-3-pyridinyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-7-(6-fluoro-3-pyridinyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90804029 |
| Molecular Formula | C24H19FN2O7 |
| Molecular Weight | 466.42 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | (4aS,5aR,12aS)-7-(6-fluoro-3-pyridinyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | NC(=O)C1C(=O)C[C@@H]2C[C@@H]3Cc4c(-c5ccc(F)nc5)ccc(O)c4C(=O)C3C(=O)[C@]2(O)C1=O |
| InChI | InChI=1S/C24H19FN2O7/c25-16-4-1-9(8-27-16)12-2-3-14(28)18-13(12)6-10-5-11-7-15(29)19(23(26)33)22(32)24(11,34)21(31)17(10)20(18)30/h1-4,8,10-11,17,19,28,34H,5-7H2,(H2,26,33)/t10-,11+,17?,19?,24+/m1/s1 |
| InChIKey | BHZSVPZNGHJNMN-FEEFVLADSA-N |
| XLogP | 0.53 |
| TPSA | 164.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.42 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|