C26H23FN2O8 — CID 91380743
(4aS,5aR,12aS)-7-[6-fluoro-5-(methoxymethyl)-3-pyridinyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91380743) has the molecular formula C26H23FN2O8 and a molecular weight of 510.47 g/mol. Its IUPAC name is (4aS,5aR,12aS)-7-[6-fluoro-5-(methoxymethyl)-3-pyridinyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-7-[6-fluoro-5-(methoxymethyl)-3-pyridinyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91380743 |
| Molecular Formula | C26H23FN2O8 |
| Molecular Weight | 510.47 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | (4aS,5aR,12aS)-7-[6-fluoro-5-(methoxymethyl)-3-pyridinyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | COCc1cc(-c2ccc(O)c3c2C[C@H]2C[C@H]4CC(=O)C(C(N)=O)C(=O)[C@@]4(O)C(=O)C2C3=O)cnc1F |
| InChI | InChI=1S/C26H23FN2O8/c1-37-9-12-4-11(8-29-24(12)27)14-2-3-16(30)19-15(14)6-10-5-13-7-17(31)20(25(28)35)23(34)26(13,36)22(33)18(10)21(19)32/h2-4,8,10,13,18,20,30,36H,5-7,9H2,1H3,(H2,28,35)/t10-,13+,18?,20?,26+/m1/s1 |
| InChIKey | GTRRJEUFVFEWFK-FBFKKKAGSA-N |
| XLogP | 0.67 |
| TPSA | 173.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.47 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|