C29H30FN3O8 — CID 58648380
(4aS,5aR,12aR)-9-[(1-fluoropropan-2-ylamino)methyl]-1,10,11,12a-tetrahydroxy-7-(6-methoxy-3-pyridinyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 58648380) has the molecular formula C29H30FN3O8 and a molecular weight of 567.57 g/mol. Its IUPAC name is (4aS,5aR,12aR)-9-[(1-fluoropropan-2-ylamino)methyl]-1,10,11,12a-tetrahydroxy-7-(6-methoxy-3-pyridinyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-9-[(1-fluoropropan-2-ylamino)methyl]-1,10,11,12a-tetrahydroxy-7-(6-methoxy-3-pyridinyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58648380 |
| Molecular Formula | C29H30FN3O8 |
| Molecular Weight | 567.57 g/mol |
| Exact Mass | 567.20 |
| IUPAC Name | (4aS,5aR,12aR)-9-[(1-fluoropropan-2-ylamino)methyl]-1,10,11,12a-tetrahydroxy-7-(6-methoxy-3-pyridinyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | COc1ccc(-c2cc(CNC(C)CF)c(O)c3c2C[C@H]2C[C@H]4CC(=O)C(C(N)=O)=C(O)[C@@]4(O)C(=O)C2=C3O)cn1 |
| InChI | InChI=1S/C29H30FN3O8/c1-12(9-30)32-11-15-7-17(13-3-4-20(41-2)33-10-13)18-6-14-5-16-8-19(34)23(28(31)39)27(38)29(16,40)26(37)21(14)25(36)22(18)24(15)35/h3-4,7,10,12,14,16,32,35-36,38,40H,5-6,8-9,11H2,1-2H3,(H2,31,39)/t12?,14-,16+,29+/m1/s1 |
| InChIKey | GLYJNDMHAZYKNY-HEKPMYSRSA-N |
| XLogP | 1.94 |
| TPSA | 192.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.57 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|