C26H24FN3O7 — CID 91008201
(4R,4aR,5aS,12aR)-4-(dimethylamino)-7-(6-fluoro-3-pyridinyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91008201) has the molecular formula C26H24FN3O7 and a molecular weight of 509.49 g/mol. Its IUPAC name is (4R,4aR,5aS,12aR)-4-(dimethylamino)-7-(6-fluoro-3-pyridinyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aS,12aR)-4-(dimethylamino)-7-(6-fluoro-3-pyridinyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91008201 |
| Molecular Formula | C26H24FN3O7 |
| Molecular Weight | 509.49 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | (4R,4aR,5aS,12aR)-4-(dimethylamino)-7-(6-fluoro-3-pyridinyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@H]1C(=O)C(C(N)=O)C(=O)[C@]2(O)C(=O)C3C(=O)c4c(O)ccc(-c5ccc(F)nc5)c4C[C@@H]3C[C@H]12 |
| InChI | InChI=1S/C26H24FN3O7/c1-30(2)20-14-8-11-7-13-12(10-3-6-16(27)29-9-10)4-5-15(31)18(13)21(32)17(11)23(34)26(14,37)24(35)19(22(20)33)25(28)36/h3-6,9,11,14,17,19-20,31,37H,7-8H2,1-2H3,(H2,28,36)/t11-,14-,17?,19?,20-,26-/m1/s1 |
| InChIKey | ZOGWDPDUOIXMKT-DKLKAJSNSA-N |
| XLogP | 0.07 |
| TPSA | 167.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.49 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|