C26H22FNO7 — CID 123344168
(4aS,5aR,12aS)-2-acetyl-7-(6-fluoro-3-pyridinyl)-10,12a-dihydroxy-9-methyl-4,4a,5,5a,6,11a-hexahydrotetracene-1,3,11,12-tetrone (PubChem CID 123344168) has the molecular formula C26H22FNO7 and a molecular weight of 479.46 g/mol. Its IUPAC name is (4aS,5aR,12aS)-2-acetyl-7-(6-fluoro-3-pyridinyl)-10,12a-dihydroxy-9-methyl-4,4a,5,5a,6,11a-hexahydrotetracene-1,3,11,12-tetrone.
| Compound Name | (4aS,5aR,12aS)-2-acetyl-7-(6-fluoro-3-pyridinyl)-10,12a-dihydroxy-9-methyl-4,4a,5,5a,6,11a-hexahydrotetracene-1,3,11,12-tetrone |
|---|---|
| PubChem CID | 123344168 |
| Molecular Formula | C26H22FNO7 |
| Molecular Weight | 479.46 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | (4aS,5aR,12aS)-2-acetyl-7-(6-fluoro-3-pyridinyl)-10,12a-dihydroxy-9-methyl-4,4a,5,5a,6,11a-hexahydrotetracene-1,3,11,12-tetrone |
| SMILES | CC(=O)C1C(=O)C[C@@H]2C[C@@H]3Cc4c(-c5ccc(F)nc5)cc(C)c(O)c4C(=O)C3C(=O)[C@]2(O)C1=O |
| InChI | InChI=1S/C26H22FNO7/c1-10-5-15(12-3-4-18(27)28-9-12)16-7-13-6-14-8-17(30)19(11(2)29)24(33)26(14,35)25(34)20(13)23(32)21(16)22(10)31/h3-5,9,13-14,19-20,31,35H,6-8H2,1-2H3/t13-,14+,19?,20?,26-/m1/s1 |
| InChIKey | IFGZYDHSIXTNNR-SXRIADQPSA-N |
| XLogP | 1.94 |
| TPSA | 138.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|