C17H30O3 — CID 123605176
(3R,4S)-5-dodec-1-enyl-4-hydroxy-3-methyloxolan-2-one (PubChem CID 123605176) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is (3R,4S)-5-dodec-1-enyl-4-hydroxy-3-methyloxolan-2-one.
| Compound Name | (3R,4S)-5-dodec-1-enyl-4-hydroxy-3-methyloxolan-2-one |
|---|---|
| PubChem CID | 123605176 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | (3R,4S)-5-dodec-1-enyl-4-hydroxy-3-methyloxolan-2-one |
| SMILES | CCCCCCCCCCC=CC1OC(=O)[C@H](C)[C@@H]1O |
| InChI | InChI=1S/C17H30O3/c1-3-4-5-6-7-8-9-10-11-12-13-15-16(18)14(2)17(19)20-15/h12-16,18H,3-11H2,1-2H3/t14-,15?,16+/m1/s1 |
| InChIKey | SRKIGGPNWIXBIQ-TUOGLVOQSA-N |
| XLogP | 4.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|