C17H26O3 — CID 11219681
(3R,4S,5S)-3-[(E)-dodec-1-en-11-ynyl]-4-hydroxy-5-methyloxolan-2-one (PubChem CID 11219681) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is (3R,4S,5S)-3-[(E)-dodec-1-en-11-ynyl]-4-hydroxy-5-methyloxolan-2-one.
| Compound Name | (3R,4S,5S)-3-[(E)-dodec-1-en-11-ynyl]-4-hydroxy-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 11219681 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (3R,4S,5S)-3-[(E)-dodec-1-en-11-ynyl]-4-hydroxy-5-methyloxolan-2-one |
| SMILES | C#CCCCCCCCC/C=C/[C@H]1C(=O)O[C@@H](C)[C@H]1O |
| InChI | InChI=1S/C17H26O3/c1-3-4-5-6-7-8-9-10-11-12-13-15-16(18)14(2)20-17(15)19/h1,12-16,18H,4-11H2,2H3/b13-12+/t14-,15+,16+/m0/s1 |
| InChIKey | PXTVBTOIMPMCRQ-JDCHRCQMSA-N |
| XLogP | 3.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|