C39H46N4S — CID 123605309
6-isocyano-7-methyl-4-(7-methyl-9,9-dioctylfluoren-2-yl)-2,1,3-benzothiadiazole-5-carbonitrile (PubChem CID 123605309) has the molecular formula C39H46N4S and a molecular weight of 602.89 g/mol. Its IUPAC name is 6-isocyano-7-methyl-4-(7-methyl-9,9-dioctylfluoren-2-yl)-2,1,3-benzothiadiazole-5-carbonitrile.
| Compound Name | 6-isocyano-7-methyl-4-(7-methyl-9,9-dioctylfluoren-2-yl)-2,1,3-benzothiadiazole-5-carbonitrile |
|---|---|
| PubChem CID | 123605309 |
| Molecular Formula | C39H46N4S |
| Molecular Weight | 602.89 g/mol |
| Exact Mass | 602.34 |
| IUPAC Name | 6-isocyano-7-methyl-4-(7-methyl-9,9-dioctylfluoren-2-yl)-2,1,3-benzothiadiazole-5-carbonitrile |
| SMILES | [C-]#[N+]c1c(C#N)c(-c2ccc3c(c2)C(CCCCCCCC)(CCCCCCCC)c2cc(C)ccc2-3)c2nsnc2c1C |
| InChI | InChI=1S/C39H46N4S/c1-6-8-10-12-14-16-22-39(23-17-15-13-11-9-7-2)33-24-27(3)18-20-30(33)31-21-19-29(25-34(31)39)35-32(26-40)36(41-5)28(4)37-38(35)43-44-42-37/h18-21,24-25H,6-17,22-23H2,1-4H3 |
| InChIKey | IFEGEJZYXDPIFQ-UHFFFAOYSA-N |
| XLogP | 12.17 |
| TPSA | 53.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.89 |
| LogP ≤ 5 | 12.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|