C23H46 — CID 123606512
1,1,2-trimethyl-3-propan-2-yl-2-tetradecan-5-ylcyclopropane (PubChem CID 123606512) has the molecular formula C23H46 and a molecular weight of 322.62 g/mol. Its IUPAC name is 1,1,2-trimethyl-3-propan-2-yl-2-tetradecan-5-ylcyclopropane.
| Compound Name | 1,1,2-trimethyl-3-propan-2-yl-2-tetradecan-5-ylcyclopropane |
|---|---|
| PubChem CID | 123606512 |
| Molecular Formula | C23H46 |
| Molecular Weight | 322.62 g/mol |
| Exact Mass | 322.36 |
| IUPAC Name | 1,1,2-trimethyl-3-propan-2-yl-2-tetradecan-5-ylcyclopropane |
| SMILES | CCCCCCCCCC(CCCC)C1(C)C(C(C)C)C1(C)C |
| InChI | InChI=1S/C23H46/c1-8-10-12-13-14-15-16-18-20(17-11-9-2)23(7)21(19(3)4)22(23,5)6/h19-21H,8-18H2,1-7H3 |
| InChIKey | WPSRZPIBSHWEJW-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.62 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|