C16H26O3 — CID 123606812
1-methoxy-5,5-dimethyl-6-(3-methylphenyl)hexane-2,4-diol (PubChem CID 123606812) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is 1-methoxy-5,5-dimethyl-6-(3-methylphenyl)hexane-2,4-diol.
| Compound Name | 1-methoxy-5,5-dimethyl-6-(3-methylphenyl)hexane-2,4-diol |
|---|---|
| PubChem CID | 123606812 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 1-methoxy-5,5-dimethyl-6-(3-methylphenyl)hexane-2,4-diol |
| SMILES | COCC(O)CC(O)C(C)(C)Cc1cccc(C)c1 |
| InChI | InChI=1S/C16H26O3/c1-12-6-5-7-13(8-12)10-16(2,3)15(18)9-14(17)11-19-4/h5-8,14-15,17-18H,9-11H2,1-4H3 |
| InChIKey | RCEWKULOPXECFT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |