C32H35F3N3O4Si+ — CID 123607589
3-[4-[5-[5-(cyclohexatrienyl)-4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-pyridinyl]phenoxy]-2,2-dimethylpropanoic acid (PubChem CID 123607589) has the molecular formula C32H35F3N3O4Si+ and a molecular weight of 610.73 g/mol. Its IUPAC name is 3-[4-[5-[5-(cyclohexatrienyl)-4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-pyridinyl]phenoxy]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[4-[5-[5-(cyclohexatrienyl)-4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-pyridinyl]phenoxy]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 123607589 |
| Molecular Formula | C32H35F3N3O4Si+ |
| Molecular Weight | 610.73 g/mol |
| Exact Mass | 610.23 |
| IUPAC Name | 3-[4-[5-[5-(cyclohexatrienyl)-4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-pyridinyl]phenoxy]-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(COc1ccc(-c2ccc(-c3nc(C(F)(F)F)c(C4=CC=[C+]C=C4)n3COCC[Si](C)(C)C)cn2)cc1)C(=O)O |
| InChI | InChI=1S/C32H34F3N3O4Si/c1-31(2,30(39)40)20-42-25-14-11-22(12-15-25)26-16-13-24(19-36-26)29-37-28(32(33,34)35)27(23-9-7-6-8-10-23)38(29)21-41-17-18-43(3,4)5/h7-16,19H,17-18,20-21H2,1-5H3/p+1 |
| InChIKey | JSRLILTYEWAFSQ-UHFFFAOYSA-O |
| XLogP | 7.75 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.73 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|