C28H28N4O4 — CID 123608319
N-[4-(5-methylhepta-2,5-dienoyl)-2,3-dihydro-1,4-benzoxazin-6-yl]-1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indole-7-carboxamide (PubChem CID 123608319) has the molecular formula C28H28N4O4 and a molecular weight of 484.56 g/mol. Its IUPAC name is N-[4-(5-methylhepta-2,5-dienoyl)-2,3-dihydro-1,4-benzoxazin-6-yl]-1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indole-7-carboxamide.
| Compound Name | N-[4-(5-methylhepta-2,5-dienoyl)-2,3-dihydro-1,4-benzoxazin-6-yl]-1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indole-7-carboxamide |
|---|---|
| PubChem CID | 123608319 |
| Molecular Formula | C28H28N4O4 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | N-[4-(5-methylhepta-2,5-dienoyl)-2,3-dihydro-1,4-benzoxazin-6-yl]-1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indole-7-carboxamide |
| SMILES | CC=C(C)CC=CC(=O)N1CCOc2ccc(NC(=O)c3ccc4cc5n(c4c3)CCNC5=O)cc21 |
| InChI | InChI=1S/C28H28N4O4/c1-3-18(2)5-4-6-26(33)32-13-14-36-25-10-9-21(17-23(25)32)30-27(34)20-8-7-19-15-24-28(35)29-11-12-31(24)22(19)16-20/h3-4,6-10,15-17H,5,11-14H2,1-2H3,(H,29,35)(H,30,34) |
| InChIKey | MUINJBJRYFWNNX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|