C24H30N4O2Si — CID 123608925
1-[4-(2-methylquinoxalin-6-yl)oxyphenyl]-N-(2-trimethylsilylethoxymethyl)propane-1,3-diimine (PubChem CID 123608925) has the molecular formula C24H30N4O2Si and a molecular weight of 434.62 g/mol. Its IUPAC name is 1-[4-(2-methylquinoxalin-6-yl)oxyphenyl]-N-(2-trimethylsilylethoxymethyl)propane-1,3-diimine.
| Compound Name | 1-[4-(2-methylquinoxalin-6-yl)oxyphenyl]-N-(2-trimethylsilylethoxymethyl)propane-1,3-diimine |
|---|---|
| PubChem CID | 123608925 |
| Molecular Formula | C24H30N4O2Si |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 1-[4-(2-methylquinoxalin-6-yl)oxyphenyl]-N-(2-trimethylsilylethoxymethyl)propane-1,3-diimine |
| SMILES | [H]/N=C/CC(=NCOCC[Si](C)(C)C)c1ccc(Oc2ccc3nc(C)cnc3c2)cc1 |
| InChI | InChI=1S/C24H30N4O2Si/c1-18-16-26-24-15-21(9-10-23(24)28-18)30-20-7-5-19(6-8-20)22(11-12-25)27-17-29-13-14-31(2,3)4/h5-10,12,15-16,25H,11,13-14,17H2,1-4H3/b25-12+,27-22? |
| InChIKey | JNAMTIXBJWXIJE-MFMRHQROSA-N |
| XLogP | 5.87 |
| TPSA | 80.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|