C11H17BrN2 — CID 123611017
3-N-benzyl-1-N-bromobutane-1,3-diamine (PubChem CID 123611017) has the molecular formula C11H17BrN2 and a molecular weight of 257.17 g/mol. Its IUPAC name is 3-N-benzyl-1-N-bromobutane-1,3-diamine.
| Compound Name | 3-N-benzyl-1-N-bromobutane-1,3-diamine |
|---|---|
| PubChem CID | 123611017 |
| Molecular Formula | C11H17BrN2 |
| Molecular Weight | 257.17 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 3-N-benzyl-1-N-bromobutane-1,3-diamine |
| SMILES | CC(CCNBr)NCc1ccccc1 |
| InChI | InChI=1S/C11H17BrN2/c1-10(7-8-14-12)13-9-11-5-3-2-4-6-11/h2-6,10,13-14H,7-9H2,1H3 |
| InChIKey | QXCRMIRKBMNLKT-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.17 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|