C11H15Cl2N — CID 162493357
N-benzyl-4,4-dichlorobutan-2-amine (PubChem CID 162493357) has the molecular formula C11H15Cl2N and a molecular weight of 232.15 g/mol. Its IUPAC name is N-benzyl-4,4-dichlorobutan-2-amine.
| Compound Name | N-benzyl-4,4-dichlorobutan-2-amine |
|---|---|
| PubChem CID | 162493357 |
| Molecular Formula | C11H15Cl2N |
| Molecular Weight | 232.15 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | N-benzyl-4,4-dichlorobutan-2-amine |
| SMILES | CC(CC(Cl)Cl)NCc1ccccc1 |
| InChI | InChI=1S/C11H15Cl2N/c1-9(7-11(12)13)14-8-10-5-3-2-4-6-10/h2-6,9,11,14H,7-8H2,1H3 |
| InChIKey | MKMGNBTXFXJPCA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.15 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|